عنوان المقالة:Immobilized-polysiloxane ethyl amino benzoate derivatives. Synthesis, characterizations and applications
أ.د نظام محمود الأشقر | Prof. Nizam M. El-Ashgar | 13587
نوع النشر
مجلة علمية
المؤلفون بالعربي
Nizam M El-Ashgar, Issa M El-Nahhal, Mohamed M Chehimi, Florence Babonneau, Jacques Livage
الملخص العربي
Insoluble solid porous ethyl-2-iminobenzoate immobilized polysiloxane ligand system of the general formula P–(CH2)3–NH(C6H4)COOC2H5, (where P represents [Si–O]n siloxane network) has been prepared by the reaction of 3-iodopolysiloxane P–(CH2)3–I with ethyl-2-aminobenzoate. The modified polysiloxane derivatives; imino(N-2-aminoethyl)benzamide P–(CH2)3–NH(C6H4)CONH(CH2)2NH2, and imino(N-diethylenediamine)benzamide P–(CH2)3–NH(C6H4)CONH(CH2)2NH(CH2)2NH2 ligand systems were prepared by the reaction of ethyl-2-iminobenzoate ligand system with ethylenediamine and diethylenetriamine, respectively. The new modified polysiloxane ligand systems exhibit high potential for the uptake of the metal ions (Mn2+, Fe3+, Co2+, Ni2+, Cu2+ and Zn2+) with an efficiency of 92–98% after recovery from its primary metal complexes. These immobilized-polysiloxane ligand systems undergo chemical degradation the level of which depends on pH.
تاريخ النشر
30/06/2005
الناشر
Reactive and Functional Polymers
رابط DOI
https://do
رابط خارجي
http://www.sciencedirect.com/science/article/pii/S1381514805000040
الكلمات المفتاحية
Metal uptake, Ethylaminobenzoate, Ethylenediamine, Diethylenetriamine polysiloxanesImmobilized-polys
رجوع